C11H23Cl3O2SiSn — CID 10527061
trimethyl-[2-[[(E,2S)-5-trichlorostannylpent-3-en-2-yl]oxymethoxy]ethyl]silane (PubChem CID 10527061) has the molecular formula C11H23Cl3O2SiSn and a molecular weight of 440.46 g/mol. Its IUPAC name is trimethyl-[2-[[(E,2S)-5-trichlorostannylpent-3-en-2-yl]oxymethoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[(E,2S)-5-trichlorostannylpent-3-en-2-yl]oxymethoxy]ethyl]silane |
|---|---|
| PubChem CID | 10527061 |
| Molecular Formula | C11H23Cl3O2SiSn |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | trimethyl-[2-[[(E,2S)-5-trichlorostannylpent-3-en-2-yl]oxymethoxy]ethyl]silane |
| SMILES | C[C@@H](/C=C/C[Sn](Cl)(Cl)Cl)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C11H23O2Si.3ClH.Sn/c1-6-7-11(2)13-10-12-8-9-14(3,4)5;;;;/h6-7,11H,1,8-10H2,2-5H3;3*1H;/q;;;;+3/p-3/b7-6+;;;;/t11-;;;;/m0..../s1 |
| InChIKey | OWKLLYXVDRKCTR-PSOIKBBJSA-K |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|