C22H52N2O4Si2 — CID 10528134
(3R,4S,5S,6R)-2,7-dimethyl-4,5-bis(2-trimethylsilylethoxymethoxy)octane-3,6-diamine (PubChem CID 10528134) has the molecular formula C22H52N2O4Si2 and a molecular weight of 464.84 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2,7-dimethyl-4,5-bis(2-trimethylsilylethoxymethoxy)octane-3,6-diamine.
| Compound Name | (3R,4S,5S,6R)-2,7-dimethyl-4,5-bis(2-trimethylsilylethoxymethoxy)octane-3,6-diamine |
|---|---|
| PubChem CID | 10528134 |
| Molecular Formula | C22H52N2O4Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | (3R,4S,5S,6R)-2,7-dimethyl-4,5-bis(2-trimethylsilylethoxymethoxy)octane-3,6-diamine |
| SMILES | CC(C)[C@@H](N)[C@H](OCOCC[Si](C)(C)C)[C@@H](OCOCC[Si](C)(C)C)[C@H](N)C(C)C |
| InChI | InChI=1S/C22H52N2O4Si2/c1-17(2)19(23)21(27-15-25-11-13-29(5,6)7)22(20(24)18(3)4)28-16-26-12-14-30(8,9)10/h17-22H,11-16,23-24H2,1-10H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | NMPUIVVBYMJTDV-CZYKHXBRSA-N |
| XLogP | 4.35 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|