C16H22O5 — CID 11822508
(2S,3S)-3-hydroxy-2-[(1R)-1-(phenylmethoxymethoxy)ethyl]hex-5-enoic acid (PubChem CID 11822508) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-[(1R)-1-(phenylmethoxymethoxy)ethyl]hex-5-enoic acid.
| Compound Name | (2S,3S)-3-hydroxy-2-[(1R)-1-(phenylmethoxymethoxy)ethyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 11822508 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-[(1R)-1-(phenylmethoxymethoxy)ethyl]hex-5-enoic acid |
| SMILES | C=CC[C@H](O)[C@H](C(=O)O)[C@@H](C)OCOCc1ccccc1 |
| InChI | InChI=1S/C16H22O5/c1-3-7-14(17)15(16(18)19)12(2)21-11-20-10-13-8-5-4-6-9-13/h3-6,8-9,12,14-15,17H,1,7,10-11H2,2H3,(H,18,19)/t12-,14+,15-/m1/s1 |
| InChIKey | SHXJGZZEALFGSZ-VHDGCEQUSA-N |
| XLogP | 2.20 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|