C22H34O4 — CID 25138493
(4S,8R,10S)-4-hydroxy-8-methyl-10-(phenylmethoxymethoxy)tridec-12-en-6-one (PubChem CID 25138493) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (4S,8R,10S)-4-hydroxy-8-methyl-10-(phenylmethoxymethoxy)tridec-12-en-6-one.
| Compound Name | (4S,8R,10S)-4-hydroxy-8-methyl-10-(phenylmethoxymethoxy)tridec-12-en-6-one |
|---|---|
| PubChem CID | 25138493 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (4S,8R,10S)-4-hydroxy-8-methyl-10-(phenylmethoxymethoxy)tridec-12-en-6-one |
| SMILES | C=CC[C@@H](C[C@@H](C)CC(=O)C[C@@H](O)CCC)OCOCc1ccccc1 |
| InChI | InChI=1S/C22H34O4/c1-4-9-20(23)15-21(24)13-18(3)14-22(10-5-2)26-17-25-16-19-11-7-6-8-12-19/h5-8,11-12,18,20,22-23H,2,4,9-10,13-17H2,1,3H3/t18-,20-,22-/m0/s1 |
| InChIKey | KQJKNCVRIIBCSQ-VCOUNFBDSA-N |
| XLogP | 4.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|