C45H74O7Si — CID 24905875
[(3S,5R)-3-[(4S,6S,8S)-6-methoxy-8-[(4-methoxyphenyl)methoxy]-4-methylundec-1-en-2-yl]oxy-5-(phenylmethoxymethoxy)hept-6-enoxy]-tri(propan-2-yl)silane (PubChem CID 24905875) has the molecular formula C45H74O7Si and a molecular weight of 755.17 g/mol. Its IUPAC name is [(3S,5R)-3-[(4S,6S,8S)-6-methoxy-8-[(4-methoxyphenyl)methoxy]-4-methylundec-1-en-2-yl]oxy-5-(phenylmethoxymethoxy)hept-6-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(3S,5R)-3-[(4S,6S,8S)-6-methoxy-8-[(4-methoxyphenyl)methoxy]-4-methylundec-1-en-2-yl]oxy-5-(phenylmethoxymethoxy)hept-6-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 24905875 |
| Molecular Formula | C45H74O7Si |
| Molecular Weight | 755.17 g/mol |
| Exact Mass | 754.52 |
| IUPAC Name | [(3S,5R)-3-[(4S,6S,8S)-6-methoxy-8-[(4-methoxyphenyl)methoxy]-4-methylundec-1-en-2-yl]oxy-5-(phenylmethoxymethoxy)hept-6-enoxy]-tri(propan-2-yl)silane |
| SMILES | C=C[C@@H](C[C@H](CCO[Si](C(C)C)(C(C)C)C(C)C)OC(=C)C[C@@H](C)C[C@@H](C[C@H](CCC)OCc1ccc(OC)cc1)OC)OCOCc1ccccc1 |
| InChI | InChI=1S/C45H74O7Si/c1-13-18-43(49-32-40-21-23-42(46-11)24-22-40)30-45(47-12)28-37(9)27-38(10)52-44(25-26-51-53(34(3)4,35(5)6)36(7)8)29-41(14-2)50-33-48-31-39-19-16-15-17-20-39/h14-17,19-24,34-37,41,43-45H,2,10,13,18,25-33H2,1,3-9,11-12H3/t37-,41+,43+,44+,45+/m1/s1 |
| InChIKey | VPTBNWYHOWNLCV-MUZLEJPQSA-N |
| XLogP | 11.82 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.17 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|