C30H42O5 — CID 25138527
[(4S,6S,8S,10S)-6-methoxy-8-methyl-10-(phenylmethoxymethoxy)tridec-12-en-4-yl] benzoate (PubChem CID 25138527) has the molecular formula C30H42O5 and a molecular weight of 482.66 g/mol. Its IUPAC name is [(4S,6S,8S,10S)-6-methoxy-8-methyl-10-(phenylmethoxymethoxy)tridec-12-en-4-yl] benzoate.
| Compound Name | [(4S,6S,8S,10S)-6-methoxy-8-methyl-10-(phenylmethoxymethoxy)tridec-12-en-4-yl] benzoate |
|---|---|
| PubChem CID | 25138527 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | [(4S,6S,8S,10S)-6-methoxy-8-methyl-10-(phenylmethoxymethoxy)tridec-12-en-4-yl] benzoate |
| SMILES | C=CC[C@@H](C[C@@H](C)C[C@@H](C[C@H](CCC)OC(=O)c1ccccc1)OC)OCOCc1ccccc1 |
| InChI | InChI=1S/C30H42O5/c1-5-13-27(34-23-33-22-25-15-9-7-10-16-25)19-24(3)20-29(32-4)21-28(14-6-2)35-30(31)26-17-11-8-12-18-26/h5,7-12,15-18,24,27-29H,1,6,13-14,19-23H2,2-4H3/t24-,27+,28+,29+/m1/s1 |
| InChIKey | ZMXAWFZPMPOWNB-KHUDPXOFSA-N |
| XLogP | 6.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|