C28H28O6 — CID 11753995
[(3R,5S)-5-benzoyloxy-7-methoxy-7-oxo-1-phenylheptan-3-yl] benzoate (PubChem CID 11753995) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is [(3R,5S)-5-benzoyloxy-7-methoxy-7-oxo-1-phenylheptan-3-yl] benzoate.
| Compound Name | [(3R,5S)-5-benzoyloxy-7-methoxy-7-oxo-1-phenylheptan-3-yl] benzoate |
|---|---|
| PubChem CID | 11753995 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [(3R,5S)-5-benzoyloxy-7-methoxy-7-oxo-1-phenylheptan-3-yl] benzoate |
| SMILES | COC(=O)C[C@H](C[C@@H](CCc1ccccc1)OC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H28O6/c1-32-26(29)20-25(34-28(31)23-15-9-4-10-16-23)19-24(18-17-21-11-5-2-6-12-21)33-27(30)22-13-7-3-8-14-22/h2-16,24-25H,17-20H2,1H3/t24-,25+/m1/s1 |
| InChIKey | KVMYBCMSNGHTTP-RPBOFIJWSA-N |
| XLogP | 5.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|