C17H21ClO6 — CID 10784518
[(2R,4R)-1-chloro-4-hydroxy-9-methoxy-6,9-dioxononan-2-yl] benzoate (PubChem CID 10784518) has the molecular formula C17H21ClO6 and a molecular weight of 356.80 g/mol. Its IUPAC name is [(2R,4R)-1-chloro-4-hydroxy-9-methoxy-6,9-dioxononan-2-yl] benzoate.
| Compound Name | [(2R,4R)-1-chloro-4-hydroxy-9-methoxy-6,9-dioxononan-2-yl] benzoate |
|---|---|
| PubChem CID | 10784518 |
| Molecular Formula | C17H21ClO6 |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [(2R,4R)-1-chloro-4-hydroxy-9-methoxy-6,9-dioxononan-2-yl] benzoate |
| SMILES | COC(=O)CCC(=O)C[C@H](O)C[C@H](CCl)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H21ClO6/c1-23-16(21)8-7-13(19)9-14(20)10-15(11-18)24-17(22)12-5-3-2-4-6-12/h2-6,14-15,20H,7-11H2,1H3/t14-,15+/m0/s1 |
| InChIKey | QBCDLCAMVGMULA-LSDHHAIUSA-N |
| XLogP | 2.11 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|