C29H48O6 — CID 102087714
[(2S)-3-hydroxy-2-(phenylmethoxymethoxy)propyl] (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 102087714) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(phenylmethoxymethoxy)propyl] (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | [(2S)-3-hydroxy-2-(phenylmethoxymethoxy)propyl] (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 102087714 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | [(2S)-3-hydroxy-2-(phenylmethoxymethoxy)propyl] (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OC[C@H](CO)OCOCc1ccccc1 |
| InChI | InChI=1S/C29H48O6/c1-2-3-4-14-19-27(31)20-15-9-7-5-6-8-10-16-21-29(32)34-24-28(22-30)35-25-33-23-26-17-12-11-13-18-26/h9,11-13,15,17-18,27-28,30-31H,2-8,10,14,16,19-25H2,1H3/b15-9-/t27-,28+/m1/s1 |
| InChIKey | XGUHOUOTDRDDLV-QKLROUEBSA-N |
| XLogP | 6.09 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|