C29H54O7 — CID 157005278
[(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate (PubChem CID 157005278) has the molecular formula C29H54O7 and a molecular weight of 514.74 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate.
| Compound Name | [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate |
|---|---|
| PubChem CID | 157005278 |
| Molecular Formula | C29H54O7 |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.39 |
| IUPAC Name | [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate |
| SMILES | CCCCC/C=C\C[C@H](O)[C@@H](O)CCCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCC |
| InChI | InChI=1S/C29H54O7/c1-3-5-7-9-12-15-19-26(31)27(32)20-16-13-10-14-18-22-29(34)36-25(23-30)24-35-28(33)21-17-11-8-6-4-2/h12,15,25-27,30-32H,3-11,13-14,16-24H2,1-2H3/b15-12-/t25-,26-,27-/m0/s1 |
| InChIKey | VVIFSARANRPVQE-PTUZYTQWSA-N |
| XLogP | 5.77 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|