C36H64O7 — CID 157005462
[(2S)-1-hydroxy-3-(10-methyldodecanoyloxy)propan-2-yl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate (PubChem CID 157005462) has the molecular formula C36H64O7 and a molecular weight of 608.90 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-(10-methyldodecanoyloxy)propan-2-yl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate.
| Compound Name | [(2S)-1-hydroxy-3-(10-methyldodecanoyloxy)propan-2-yl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 157005462 |
| Molecular Formula | C36H64O7 |
| Molecular Weight | 608.90 g/mol |
| Exact Mass | 608.47 |
| IUPAC Name | [(2S)-1-hydroxy-3-(10-methyldodecanoyloxy)propan-2-yl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC(O)C(O)CCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C36H64O7/c1-4-6-7-8-9-10-11-12-13-14-18-21-25-33(38)34(39)26-23-28-36(41)43-32(29-37)30-42-35(40)27-22-19-16-15-17-20-24-31(3)5-2/h9-10,12-13,18,21,31-34,37-39H,4-8,11,14-17,19-20,22-30H2,1-3H3/b10-9-,13-12-,21-18-/t31?,32-,33?,34?/m0/s1 |
| InChIKey | ZCTWMWAMUYXALL-WLGWGOQCSA-N |
| XLogP | 7.91 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.90 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|