C36H66O5 — CID 56936372
[(2S)-1-hydroxy-3-[(Z)-pentadec-9-enoyl]oxypropan-2-yl] (Z)-octadec-9-enoate (PubChem CID 56936372) has the molecular formula C36H66O5 and a molecular weight of 578.92 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-[(Z)-pentadec-9-enoyl]oxypropan-2-yl] (Z)-octadec-9-enoate.
| Compound Name | [(2S)-1-hydroxy-3-[(Z)-pentadec-9-enoyl]oxypropan-2-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 56936372 |
| Molecular Formula | C36H66O5 |
| Molecular Weight | 578.92 g/mol |
| Exact Mass | 578.49 |
| IUPAC Name | [(2S)-1-hydroxy-3-[(Z)-pentadec-9-enoyl]oxypropan-2-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C36H66O5/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-36(39)41-34(32-37)33-40-35(38)30-28-26-24-22-20-16-14-12-10-8-6-4-2/h12,14,17-18,34,37H,3-11,13,15-16,19-33H2,1-2H3/b14-12-,18-17-/t34-/m0/s1 |
| InChIKey | OALWFBDEUFFROY-KBMTVBSSSA-N |
| XLogP | 10.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.92 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|