C57H104O10 — CID 76830406
[3-(12,13-dihydroxyoctadec-9-enoyloxy)-2-octadec-9-enoyloxypropyl] 9,10-dihydroxyoctadec-12-enoate (PubChem CID 76830406) has the molecular formula C57H104O10 and a molecular weight of 949.45 g/mol. Its IUPAC name is [3-(12,13-dihydroxyoctadec-9-enoyloxy)-2-octadec-9-enoyloxypropyl] 9,10-dihydroxyoctadec-12-enoate.
| Compound Name | [3-(12,13-dihydroxyoctadec-9-enoyloxy)-2-octadec-9-enoyloxypropyl] 9,10-dihydroxyoctadec-12-enoate |
|---|---|
| PubChem CID | 76830406 |
| Molecular Formula | C57H104O10 |
| Molecular Weight | 949.45 g/mol |
| Exact Mass | 948.76 |
| IUPAC Name | [3-(12,13-dihydroxyoctadec-9-enoyloxy)-2-octadec-9-enoyloxypropyl] 9,10-dihydroxyoctadec-12-enoate |
| SMILES | CCCCCC=CCC(O)C(O)CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC(O)C(O)CCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C57H104O10/c1-4-7-10-12-14-15-16-17-18-19-20-21-26-32-40-47-57(64)67-50(48-65-55(62)45-38-31-25-23-22-24-29-36-43-52(59)51(58)41-34-9-6-3)49-66-56(63)46-39-33-27-30-37-44-54(61)53(60)42-35-28-13-11-8-5-2/h17-18,28-29,35-36,50-54,58-61H,4-16,19-27,30-34,37-49H2,1-3H3 |
| InChIKey | FPUKPCJIYCELEF-UHFFFAOYSA-N |
| XLogP | 13.98 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.45 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|