C57H106O8 — CID 102476861
2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl 9,10-dihydroxyoctadecanoate (PubChem CID 102476861) has the molecular formula C57H106O8 and a molecular weight of 919.47 g/mol. Its IUPAC name is 2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl 9,10-dihydroxyoctadecanoate.
| Compound Name | 2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl 9,10-dihydroxyoctadecanoate |
|---|---|
| PubChem CID | 102476861 |
| Molecular Formula | C57H106O8 |
| Molecular Weight | 919.47 g/mol |
| Exact Mass | 918.79 |
| IUPAC Name | 2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl 9,10-dihydroxyoctadecanoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC(O)C(O)CCCCCCCC)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C57H106O8/c1-4-7-10-13-16-18-20-22-24-26-28-30-32-37-42-47-55(60)63-50-52(65-57(62)49-44-38-33-31-29-27-25-23-21-19-17-14-11-8-5-2)51-64-56(61)48-43-39-34-36-41-46-54(59)53(58)45-40-35-15-12-9-6-3/h22-25,52-54,58-59H,4-21,26-51H2,1-3H3/b24-22+,25-23+ |
| InChIKey | DIHPQUIMMMVUBJ-BQASJOSNSA-N |
| XLogP | 16.26 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.47 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|