C24H46O5 — CID 155355400
2,3-dihydroxypropyl (Z)-12-hydroxyoctadec-9-enoate;prop-1-ene (PubChem CID 155355400) has the molecular formula C24H46O5 and a molecular weight of 414.63 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (Z)-12-hydroxyoctadec-9-enoate;prop-1-ene.
| Compound Name | 2,3-dihydroxypropyl (Z)-12-hydroxyoctadec-9-enoate;prop-1-ene |
|---|---|
| PubChem CID | 155355400 |
| Molecular Formula | C24H46O5 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | 2,3-dihydroxypropyl (Z)-12-hydroxyoctadec-9-enoate;prop-1-ene |
| SMILES | C=CC.CCCCCCC(O)C/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H40O5.C3H6/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-16-21(25)26-18-20(24)17-22;1-3-2/h9,12,19-20,22-24H,2-8,10-11,13-18H2,1H3;3H,1H2,2H3/b12-9-; |
| InChIKey | TZERIIRBJIDQQN-MWMYENNMSA-N |
| XLogP | 5.08 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|