C16H32O4 — CID 155355395
2,3-dihydroxypropyl decanoate;prop-1-ene (PubChem CID 155355395) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2,3-dihydroxypropyl decanoate;prop-1-ene.
| Compound Name | 2,3-dihydroxypropyl decanoate;prop-1-ene |
|---|---|
| PubChem CID | 155355395 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2,3-dihydroxypropyl decanoate;prop-1-ene |
| SMILES | C=CC.CCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C13H26O4.C3H6/c1-2-3-4-5-6-7-8-9-13(16)17-11-12(15)10-14;1-3-2/h12,14-15H,2-11H2,1H3;3H,1H2,2H3 |
| InChIKey | SJFLYOSAGFXNNA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|