C18H27NO4 — CID 67833212
2-(1-hydroxyethyl)-4-methyl-5-phenylmethoxy-3-(prop-2-enylamino)pentanoic acid (PubChem CID 67833212) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-4-methyl-5-phenylmethoxy-3-(prop-2-enylamino)pentanoic acid.
| Compound Name | 2-(1-hydroxyethyl)-4-methyl-5-phenylmethoxy-3-(prop-2-enylamino)pentanoic acid |
|---|---|
| PubChem CID | 67833212 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-(1-hydroxyethyl)-4-methyl-5-phenylmethoxy-3-(prop-2-enylamino)pentanoic acid |
| SMILES | C=CCNC(C(C)COCc1ccccc1)C(C(=O)O)C(C)O |
| InChI | InChI=1S/C18H27NO4/c1-4-10-19-17(16(14(3)20)18(21)22)13(2)11-23-12-15-8-6-5-7-9-15/h4-9,13-14,16-17,19-20H,1,10-12H2,2-3H3,(H,21,22) |
| InChIKey | RDECUUCBVROIQZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|