C27H42O8Si — CID 10768350
[(1S,4R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylidene-4-(2-trimethylsilylethoxymethoxy)pentyl] (2S)-2-acetyloxy-2-phenylacetate (PubChem CID 10768350) has the molecular formula C27H42O8Si and a molecular weight of 522.71 g/mol. Its IUPAC name is [(1S,4R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylidene-4-(2-trimethylsilylethoxymethoxy)pentyl] (2S)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(1S,4R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylidene-4-(2-trimethylsilylethoxymethoxy)pentyl] (2S)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 10768350 |
| Molecular Formula | C27H42O8Si |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | [(1S,4R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylidene-4-(2-trimethylsilylethoxymethoxy)pentyl] (2S)-2-acetyloxy-2-phenylacetate |
| SMILES | C=C(C[C@H](OC(=O)[C@@H](OC(C)=O)c1ccccc1)[C@H]1COC(C)(C)O1)[C@@H](C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C27H42O8Si/c1-19(20(2)31-18-30-14-15-36(6,7)8)16-23(24-17-32-27(4,5)35-24)34-26(29)25(33-21(3)28)22-12-10-9-11-13-22/h9-13,20,23-25H,1,14-18H2,2-8H3/t20-,23+,24-,25+/m1/s1 |
| InChIKey | CXNYPOHNPZMKON-YFJHUXEUSA-N |
| XLogP | 5.02 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|