C21H40O7Si — CID 15663110
2-[[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-(2-methoxyprop-2-enyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]methoxy]ethyl-trimethylsilane (PubChem CID 15663110) has the molecular formula C21H40O7Si and a molecular weight of 432.63 g/mol. Its IUPAC name is 2-[[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-(2-methoxyprop-2-enyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-(2-methoxyprop-2-enyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 15663110 |
| Molecular Formula | C21H40O7Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-[[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-(2-methoxyprop-2-enyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]methoxy]ethyl-trimethylsilane |
| SMILES | C=C(C[C@H]1OC(C)(C)O[C@H]1[C@H](OCOCC[Si](C)(C)C)[C@H]1COC(C)(C)O1)OC |
| InChI | InChI=1S/C21H40O7Si/c1-15(22-6)12-16-19(28-21(4,5)26-16)18(17-13-25-20(2,3)27-17)24-14-23-10-11-29(7,8)9/h16-19H,1,10-14H2,2-9H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | KYDYKCXCWMLKPE-NCXUSEDFSA-N |
| XLogP | 3.91 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|