C18H40O5Si2 — CID 10572619
(4S,6S)-2,2-dimethyl-4,6-bis(2-trimethylsilylethoxymethyl)-1,3-dioxan-5-ol (PubChem CID 10572619) has the molecular formula C18H40O5Si2 and a molecular weight of 392.69 g/mol. Its IUPAC name is (4S,6S)-2,2-dimethyl-4,6-bis(2-trimethylsilylethoxymethyl)-1,3-dioxan-5-ol.
| Compound Name | (4S,6S)-2,2-dimethyl-4,6-bis(2-trimethylsilylethoxymethyl)-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 10572619 |
| Molecular Formula | C18H40O5Si2 |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (4S,6S)-2,2-dimethyl-4,6-bis(2-trimethylsilylethoxymethyl)-1,3-dioxan-5-ol |
| SMILES | CC1(C)O[C@@H](COCC[Si](C)(C)C)C(O)[C@H](COCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C18H40O5Si2/c1-18(2)22-15(13-20-9-11-24(3,4)5)17(19)16(23-18)14-21-10-12-25(6,7)8/h15-17,19H,9-14H2,1-8H3/t15-,16-/m0/s1 |
| InChIKey | XTKAPAWLNZHDOJ-HOTGVXAUSA-N |
| XLogP | 3.58 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|