C12H21FOSi — CID 171778876
2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 171778876) has the molecular formula C12H21FOSi and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171778876 |
| Molecular Formula | C12H21FOSi |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCC1C=CC(F)=CC1 |
| InChI | InChI=1S/C12H21FOSi/c1-15(2,3)9-8-14-10-11-4-6-12(13)7-5-11/h4,6-7,11H,5,8-10H2,1-3H3 |
| InChIKey | XVIKBAIRXRGNAB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|