About 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane
2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 171778876) has the molecular formula C12H21FOSi
and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane |
| PubChem CID | 171778876 |
| Molecular Formula | C12H21FOSi |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCC1C=CC(F)=CC1 |
| InChI | InChI=1S/C12H21FOSi/c1-15(2,3)9-8-14-10-11-4-6-12(13)7-5-11/h4,6-7,11H,5,8-10H2,1-3H3 |
| InChIKey | XVIKBAIRXRGNAB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane?
The IUPAC name of 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane (CID 171778876) is 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane.
What is the SMILES notation for 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane?
The canonical SMILES for 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane is C[Si](C)(C)CCOCC1C=CC(F)=CC1.
What is the InChIKey of 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane?
The InChIKey is XVIKBAIRXRGNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21FOSi/c1-15(2,3)9-8-14-10-11-4-6-12(13)7-5-11/h4,6-7,11H,5,8-10H2,1-3H3.
What are the key properties of 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane?
2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane has a molecular weight of 228.38 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorocyclohexa-2,4-dien-1-yl)methoxy]ethyl-trimethylsilane is sourced from PubChem (CID 171778876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).