C19H37NO7 — CID 11361329
5-[[(4S,5R)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(methoxymethoxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pentan-1-amine (PubChem CID 11361329) has the molecular formula C19H37NO7 and a molecular weight of 391.51 g/mol. Its IUPAC name is 5-[[(4S,5R)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(methoxymethoxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pentan-1-amine.
| Compound Name | 5-[[(4S,5R)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(methoxymethoxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pentan-1-amine |
|---|---|
| PubChem CID | 11361329 |
| Molecular Formula | C19H37NO7 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 5-[[(4S,5R)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(methoxymethoxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pentan-1-amine |
| SMILES | COCO[C@H]([C@@H]1OC(C)(C)O[C@H]1COCCCCCN)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H37NO7/c1-18(2)24-12-15(25-18)16(23-13-21-5)17-14(26-19(3,4)27-17)11-22-10-8-6-7-9-20/h14-17H,6-13,20H2,1-5H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | UTWJESDFVPJAMT-VVLHAWIVSA-N |
| XLogP | 1.79 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|