C18H34O12S2 — CID 10951276
[(3S,4R)-4-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-4-methylsulfonyloxybutyl] methanesulfonate (PubChem CID 10951276) has the molecular formula C18H34O12S2 and a molecular weight of 506.59 g/mol. Its IUPAC name is [(3S,4R)-4-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-4-methylsulfonyloxybutyl] methanesulfonate.
| Compound Name | [(3S,4R)-4-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-4-methylsulfonyloxybutyl] methanesulfonate |
|---|---|
| PubChem CID | 10951276 |
| Molecular Formula | C18H34O12S2 |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | [(3S,4R)-4-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-4-methylsulfonyloxybutyl] methanesulfonate |
| SMILES | COCO[C@@H](CCOS(C)(=O)=O)[C@@H](OS(C)(=O)=O)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H34O12S2/c1-17(2)25-10-13(27-17)14-16(29-18(3,4)28-14)15(30-32(7,21)22)12(24-11-23-5)8-9-26-31(6,19)20/h12-16H,8-11H2,1-7H3/t12-,13+,14+,15+,16-/m0/s1 |
| InChIKey | GPXIHGYJQLZTJC-GCSSGZNBSA-N |
| XLogP | 0.36 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|