C13H24O6S — CID 59906162
2-[(2S,3S,4R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyloxolan-3-yl]ethyl methanesulfonate (PubChem CID 59906162) has the molecular formula C13H24O6S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[(2S,3S,4R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyloxolan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(2S,3S,4R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyloxolan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 59906162 |
| Molecular Formula | C13H24O6S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[(2S,3S,4R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyloxolan-3-yl]ethyl methanesulfonate |
| SMILES | C[C@H]1CO[C@H]([C@H]2COC(C)(C)O2)[C@H]1CCOS(C)(=O)=O |
| InChI | InChI=1S/C13H24O6S/c1-9-7-16-12(11-8-17-13(2,3)19-11)10(9)5-6-18-20(4,14)15/h9-12H,5-8H2,1-4H3/t9-,10-,11+,12-/m0/s1 |
| InChIKey | LCVKDEXOBFTJKP-YFKTTZPYSA-N |
| XLogP | 1.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|