C10H16O7S — CID 22845692
[(3R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxooxolan-3-yl] methanesulfonate (PubChem CID 22845692) has the molecular formula C10H16O7S and a molecular weight of 280.30 g/mol. Its IUPAC name is [(3R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxooxolan-3-yl] methanesulfonate.
| Compound Name | [(3R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxooxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 22845692 |
| Molecular Formula | C10H16O7S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | [(3R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxooxolan-3-yl] methanesulfonate |
| SMILES | CC1(C)OC[C@H]([C@H]2C[C@@H](OS(C)(=O)=O)C(=O)O2)O1 |
| InChI | InChI=1S/C10H16O7S/c1-10(2)14-5-8(16-10)6-4-7(9(11)15-6)17-18(3,12)13/h6-8H,4-5H2,1-3H3/t6-,7-,8-/m1/s1 |
| InChIKey | SSPNCWSTAHYGAD-BWZBUEFSSA-N |
| XLogP | -0.20 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|