C11H20O5S — CID 145095983
2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]ethyl methanesulfonate (PubChem CID 145095983) has the molecular formula C11H20O5S and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 145095983 |
| Molecular Formula | C11H20O5S |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C11H20O5S/c1-17(12,13)15-8-5-10-9-14-11(16-10)6-3-2-4-7-11/h10H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | IYKIGVCUPZQGEI-SNVBAGLBSA-N |
| XLogP | 1.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|