C11H23N3O6S — CID 159945333
2-(1,4-dioxaspiro[4.6]undecan-3-ylmethyl)guanidine;sulfuric acid (PubChem CID 159945333) has the molecular formula C11H23N3O6S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.6]undecan-3-ylmethyl)guanidine;sulfuric acid.
| Compound Name | 2-(1,4-dioxaspiro[4.6]undecan-3-ylmethyl)guanidine;sulfuric acid |
|---|---|
| PubChem CID | 159945333 |
| Molecular Formula | C11H23N3O6S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-(1,4-dioxaspiro[4.6]undecan-3-ylmethyl)guanidine;sulfuric acid |
| SMILES | NC(N)=NCC1COC2(CCCCCC2)O1.O=S(=O)(O)O |
| InChI | InChI=1S/C11H21N3O2.H2O4S/c12-10(13)14-7-9-8-15-11(16-9)5-3-1-2-4-6-11;1-5(2,3)4/h9H,1-8H2,(H4,12,13,14);(H2,1,2,3,4) |
| InChIKey | OBKGEUUWWCHWTB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|