C16H25BrO6 — CID 101206021
(4S,5S)-4-[(1R)-4-bromo-1-(methoxymethoxy)but-3-ynyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 101206021) has the molecular formula C16H25BrO6 and a molecular weight of 393.27 g/mol. Its IUPAC name is (4S,5S)-4-[(1R)-4-bromo-1-(methoxymethoxy)but-3-ynyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-[(1R)-4-bromo-1-(methoxymethoxy)but-3-ynyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 101206021 |
| Molecular Formula | C16H25BrO6 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (4S,5S)-4-[(1R)-4-bromo-1-(methoxymethoxy)but-3-ynyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | COCO[C@H](CC#CBr)[C@@H]1OC(C)(C)O[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H25BrO6/c1-15(2)20-9-12(21-15)14-13(22-16(3,4)23-14)11(7-6-8-17)19-10-18-5/h11-14H,7,9-10H2,1-5H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | ZBAZYNIWCMMLTC-MQYQWHSLSA-N |
| XLogP | 2.39 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|