C11H17NO5 — CID 101003430
(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonitrile oxide (PubChem CID 101003430) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonitrile oxide.
| Compound Name | (4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonitrile oxide |
|---|---|
| PubChem CID | 101003430 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonitrile oxide |
| SMILES | CC1(C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H](C#[N+][O-])O1 |
| InChI | InChI=1S/C11H17NO5/c1-10(2)14-6-8(16-10)9-7(5-12-13)15-11(3,4)17-9/h7-9H,6H2,1-4H3/t7-,8-,9+/m1/s1 |
| InChIKey | PHJHRZFWVDVSBA-HLTSFMKQSA-N |
| XLogP | 1.49 |
| TPSA | 64.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|