C22H36O8 — CID 101004851
(4S,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(Z)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 101004851) has the molecular formula C22H36O8 and a molecular weight of 428.52 g/mol. Its IUPAC name is (4S,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(Z)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(Z)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 101004851 |
| Molecular Formula | C22H36O8 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (4S,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(Z)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H](/C=C\[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C22H36O8/c1-19(2)23-11-15(27-19)17-13(25-21(5,6)29-17)9-10-14-18(30-22(7,8)26-14)16-12-24-20(3,4)28-16/h9-10,13-18H,11-12H2,1-8H3/b10-9-/t13-,14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | MQOQZLMAMCZKHT-LOVBRFJPSA-N |
| XLogP | 2.89 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|