C13H21ClO4 — CID 10869569
(4S,5R)-4-[(E)-3-chloroprop-1-enyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10869569) has the molecular formula C13H21ClO4 and a molecular weight of 276.76 g/mol. Its IUPAC name is (4S,5R)-4-[(E)-3-chloroprop-1-enyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(E)-3-chloroprop-1-enyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10869569 |
| Molecular Formula | C13H21ClO4 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (4S,5R)-4-[(E)-3-chloroprop-1-enyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H]([C@H]2COC(C)(C)O2)[C@H](/C=C/CCl)O1 |
| InChI | InChI=1S/C13H21ClO4/c1-12(2)15-8-10(17-12)11-9(6-5-7-14)16-13(3,4)18-11/h5-6,9-11H,7-8H2,1-4H3/b6-5+/t9-,10+,11+/m0/s1 |
| InChIKey | WCWWLZSCFCKOBH-ARGPXSTMSA-N |
| XLogP | 2.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|