C13H21ClO6 — CID 118047583
[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2-chloroacetate (PubChem CID 118047583) has the molecular formula C13H21ClO6 and a molecular weight of 308.76 g/mol. Its IUPAC name is [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2-chloroacetate.
| Compound Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2-chloroacetate |
|---|---|
| PubChem CID | 118047583 |
| Molecular Formula | C13H21ClO6 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2-chloroacetate |
| SMILES | CC1(C)OCC(C2OC(C)(C)OC2COC(=O)CCl)O1 |
| InChI | InChI=1S/C13H21ClO6/c1-12(2)17-7-9(18-12)11-8(6-16-10(15)5-14)19-13(3,4)20-11/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | GBDIGQBWVVVKAE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|