C18H22Cl3NO7 — CID 18634361
[(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate (PubChem CID 18634361) has the molecular formula C18H22Cl3NO7 and a molecular weight of 470.73 g/mol. Its IUPAC name is [(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate.
| Compound Name | [(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 18634361 |
| Molecular Formula | C18H22Cl3NO7 |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | [(4S,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
| SMILES | CC1(C)OC[C@@H]([C@@H]2OC(C)(C)O[C@H]2COC(=O)COc2nc(Cl)c(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C18H22Cl3NO7/c1-17(2)26-7-12(27-17)14-11(28-18(3,4)29-14)6-24-13(23)8-25-16-10(20)5-9(19)15(21)22-16/h5,11-12,14H,6-8H2,1-4H3/t11-,12-,14+/m0/s1 |
| InChIKey | MPLUCNXARUOIMM-SGMGOOAPSA-N |
| XLogP | 3.64 |
| TPSA | 85.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|