C9H8Cl3NO3 — CID 3085207
ethyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate (PubChem CID 3085207) has the molecular formula C9H8Cl3NO3 and a molecular weight of 284.53 g/mol. Its IUPAC name is ethyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate.
| Compound Name | ethyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 3085207 |
| Molecular Formula | C9H8Cl3NO3 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 282.96 |
| IUPAC Name | ethyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
| SMILES | CCOC(=O)COc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl3NO3/c1-2-15-7(14)4-16-9-6(11)3-5(10)8(12)13-9/h3H,2,4H2,1H3 |
| InChIKey | KXAVVWXJUDQGDA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|