C13H16Cl3NO4 — CID 6420749
ethyl 2-butoxy-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate (PubChem CID 6420749) has the molecular formula C13H16Cl3NO4 and a molecular weight of 356.63 g/mol. Its IUPAC name is ethyl 2-butoxy-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate.
| Compound Name | ethyl 2-butoxy-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 6420749 |
| Molecular Formula | C13H16Cl3NO4 |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | ethyl 2-butoxy-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
| SMILES | CCCCOC(Oc1nc(Cl)c(Cl)cc1Cl)C(=O)OCC |
| InChI | InChI=1S/C13H16Cl3NO4/c1-3-5-6-20-13(12(18)19-4-2)21-11-9(15)7-8(14)10(16)17-11/h7,13H,3-6H2,1-2H3 |
| InChIKey | SDDTVXWNHUVYCI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|