C7H4Cl3NO3 — CID 13067048
2-[(3,4,6-trichloro-2-pyridinyl)oxy]acetic acid (PubChem CID 13067048) has the molecular formula C7H4Cl3NO3 and a molecular weight of 256.47 g/mol. Its IUPAC name is 2-[(3,4,6-trichloro-2-pyridinyl)oxy]acetic acid.
| Compound Name | 2-[(3,4,6-trichloro-2-pyridinyl)oxy]acetic acid |
|---|---|
| PubChem CID | 13067048 |
| Molecular Formula | C7H4Cl3NO3 |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | 2-[(3,4,6-trichloro-2-pyridinyl)oxy]acetic acid |
| SMILES | O=C(O)COc1nc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C7H4Cl3NO3/c8-3-1-4(9)11-7(6(3)10)14-2-5(12)13/h1H,2H2,(H,12,13) |
| InChIKey | PDUDDXUOBMMYTJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|