C13H13Cl3N4O2 — CID 19890364
N-(2-ethyl-5-methylpyrazol-3-yl)-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide (PubChem CID 19890364) has the molecular formula C13H13Cl3N4O2 and a molecular weight of 363.63 g/mol. Its IUPAC name is N-(2-ethyl-5-methylpyrazol-3-yl)-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide.
| Compound Name | N-(2-ethyl-5-methylpyrazol-3-yl)-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 19890364 |
| Molecular Formula | C13H13Cl3N4O2 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-(2-ethyl-5-methylpyrazol-3-yl)-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide |
| SMILES | CCn1nc(C)cc1NC(=O)COc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl3N4O2/c1-3-20-10(4-7(2)19-20)17-11(21)6-22-13-9(15)5-8(14)12(16)18-13/h4-5H,3,6H2,1-2H3,(H,17,21) |
| InChIKey | LFGWDVOLXZDSJQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|