C9H15N3O2 — CID 154882023
methyl 2-[(2-ethyl-5-methylpyrazol-3-yl)amino]acetate (PubChem CID 154882023) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is methyl 2-[(2-ethyl-5-methylpyrazol-3-yl)amino]acetate.
| Compound Name | methyl 2-[(2-ethyl-5-methylpyrazol-3-yl)amino]acetate |
|---|---|
| PubChem CID | 154882023 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | methyl 2-[(2-ethyl-5-methylpyrazol-3-yl)amino]acetate |
| SMILES | CCn1nc(C)cc1NCC(=O)OC |
| InChI | InChI=1S/C9H15N3O2/c1-4-12-8(5-7(2)11-12)10-6-9(13)14-3/h5,10H,4,6H2,1-3H3 |
| InChIKey | WWDCFIDVLGYZDD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |