C16H24F4O10S — CID 118311359
4-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxycarbonyloxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 118311359) has the molecular formula C16H24F4O10S and a molecular weight of 484.42 g/mol. Its IUPAC name is 4-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxycarbonyloxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxycarbonyloxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 118311359 |
| Molecular Formula | C16H24F4O10S |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxycarbonyloxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | CC1(C)OCC(C2OC(C)(C)OC2COC(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)O)O1 |
| InChI | InChI=1S/C16H24F4O10S/c1-13(2)27-8-10(28-13)11-9(29-14(3,4)30-11)7-26-12(21)25-6-5-15(17,18)16(19,20)31(22,23)24/h9-11H,5-8H2,1-4H3,(H,22,23,24) |
| InChIKey | KACZBMQVYUVTDF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|