C15H27BrO3Si — CID 101161098
[(1S)-4-bromo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-ynoxy]-tert-butyl-dimethylsilane (PubChem CID 101161098) has the molecular formula C15H27BrO3Si and a molecular weight of 363.37 g/mol. Its IUPAC name is [(1S)-4-bromo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-ynoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-4-bromo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-ynoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101161098 |
| Molecular Formula | C15H27BrO3Si |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [(1S)-4-bromo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-ynoxy]-tert-butyl-dimethylsilane |
| SMILES | CC1(C)OC[C@H]([C@H](CC#CBr)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H27BrO3Si/c1-14(2,3)20(6,7)19-12(9-8-10-16)13-11-17-15(4,5)18-13/h12-13H,9,11H2,1-7H3/t12-,13+/m0/s1 |
| InChIKey | AAYIFQLLWIXFMD-QWHCGFSZSA-N |
| XLogP | 4.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|