C16H31NO4Si — CID 11624065
(5R)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one (PubChem CID 11624065) has the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. Its IUPAC name is (5R)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11624065 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (5R)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrrolidin-2-one |
| SMILES | CC1(C)OC[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2CCC(=O)N2)O1 |
| InChI | InChI=1S/C16H31NO4Si/c1-15(2,3)22(6,7)21-14(11-8-9-13(18)17-11)12-10-19-16(4,5)20-12/h11-12,14H,8-10H2,1-7H3,(H,17,18)/t11-,12-,14+/m1/s1 |
| InChIKey | FQSRLZUDCMJCOQ-BZPMIXESSA-N |
| XLogP | 2.81 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|