C28H45NO8Si — CID 134845723
(4R)-4-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 134845723) has the molecular formula C28H45NO8Si and a molecular weight of 551.75 g/mol. Its IUPAC name is (4R)-4-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134845723 |
| Molecular Formula | C28H45NO8Si |
| Molecular Weight | 551.75 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | (4R)-4-[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)OC[C@@H]2[C@H]2OC(C)(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C28H45NO8Si/c1-26(2,3)38(9,10)37-23(21-17-33-27(4,5)34-21)24-22(35-28(6,7)36-24)20-16-32-25(30)29(20)15-18-11-13-19(31-8)14-12-18/h11-14,20-24H,15-17H2,1-10H3/t20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | CFGMBNIABILEIR-MRKXFKPJSA-N |
| XLogP | 5.08 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|