C26H44O8Si — CID 14104671
(2Z)-2-[[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-1,4-dioxaspiro[4.5]decan-3-one (PubChem CID 14104671) has the molecular formula C26H44O8Si and a molecular weight of 512.72 g/mol. Its IUPAC name is (2Z)-2-[[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-1,4-dioxaspiro[4.5]decan-3-one.
| Compound Name | (2Z)-2-[[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-1,4-dioxaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 14104671 |
| Molecular Formula | C26H44O8Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (2Z)-2-[[(4R,5R)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-1,4-dioxaspiro[4.5]decan-3-one |
| SMILES | CC1(C)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H]2COC(C)(C)O2)[C@@H](/C=C2\OC3(CCCCC3)OC2=O)O1 |
| InChI | InChI=1S/C26H44O8Si/c1-23(2,3)35(8,9)34-21(19-16-28-24(4,5)30-19)20-17(29-25(6,7)32-20)15-18-22(27)33-26(31-18)13-11-10-12-14-26/h15,17,19-21H,10-14,16H2,1-9H3/b18-15-/t17-,19-,20-,21-/m1/s1 |
| InChIKey | AQZPHCWKVHHBIX-YBTSHRNRSA-N |
| XLogP | 5.17 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|