C11H16ClNO3 — CID 56849943
ethyl (E,5S)-5-amino-5-(furan-2-yl)pent-2-enoate;hydrochloride (PubChem CID 56849943) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is ethyl (E,5S)-5-amino-5-(furan-2-yl)pent-2-enoate;hydrochloride.
| Compound Name | ethyl (E,5S)-5-amino-5-(furan-2-yl)pent-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 56849943 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | ethyl (E,5S)-5-amino-5-(furan-2-yl)pent-2-enoate;hydrochloride |
| SMILES | CCOC(=O)/C=C/C[C@H](N)c1ccco1.Cl |
| InChI | InChI=1S/C11H15NO3.ClH/c1-2-14-11(13)7-3-5-9(12)10-6-4-8-15-10;/h3-4,6-9H,2,5,12H2,1H3;1H/b7-3+;/t9-;/m0./s1 |
| InChIKey | DUZVSGRBUZWBBP-HSIPJNEWSA-N |
| XLogP | 2.21 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|