C9H14N2O2 — CID 82075111
3-amino-3-(furan-2-yl)-N,N-dimethylpropanamide (PubChem CID 82075111) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-amino-3-(furan-2-yl)-N,N-dimethylpropanamide.
| Compound Name | 3-amino-3-(furan-2-yl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 82075111 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-amino-3-(furan-2-yl)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CC(N)c1ccco1 |
| InChI | InChI=1S/C9H14N2O2/c1-11(2)9(12)6-7(10)8-4-3-5-13-8/h3-5,7H,6,10H2,1-2H3 |
| InChIKey | IFUITCPPBQFSDS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |