C18H27NO5 — CID 101271254
ethyl (E)-5-[furan-2-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoate (PubChem CID 101271254) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl (E)-5-[furan-2-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoate.
| Compound Name | ethyl (E)-5-[furan-2-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoate |
|---|---|
| PubChem CID | 101271254 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ethyl (E)-5-[furan-2-ylmethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoate |
| SMILES | CCOC(=O)/C=C/CC(C)N(Cc1ccco1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO5/c1-6-22-16(20)11-7-9-14(2)19(13-15-10-8-12-23-15)17(21)24-18(3,4)5/h7-8,10-12,14H,6,9,13H2,1-5H3/b11-7+ |
| InChIKey | NEZLNWAUYDWZEL-YRNVUSSQSA-N |
| XLogP | 3.91 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|