C14H19NO3 — CID 80549181
ethyl (E)-4-[cyclopropyl(furan-2-ylmethyl)amino]but-2-enoate (PubChem CID 80549181) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethyl (E)-4-[cyclopropyl(furan-2-ylmethyl)amino]but-2-enoate.
| Compound Name | ethyl (E)-4-[cyclopropyl(furan-2-ylmethyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 80549181 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | ethyl (E)-4-[cyclopropyl(furan-2-ylmethyl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C14H19NO3/c1-2-17-14(16)6-3-9-15(12-7-8-12)11-13-5-4-10-18-13/h3-6,10,12H,2,7-9,11H2,1H3/b6-3+ |
| InChIKey | IEXIGABPLGGRPB-ZZXKWVIFSA-N |
| XLogP | 2.36 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|