C15H17NO2S — CID 62030109
2-[cyclopropyl(furan-2-ylmethyl)amino]-1-(5-methylthiophen-2-yl)ethanone (PubChem CID 62030109) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-[cyclopropyl(furan-2-ylmethyl)amino]-1-(5-methylthiophen-2-yl)ethanone.
| Compound Name | 2-[cyclopropyl(furan-2-ylmethyl)amino]-1-(5-methylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 62030109 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[cyclopropyl(furan-2-ylmethyl)amino]-1-(5-methylthiophen-2-yl)ethanone |
| SMILES | Cc1ccc(C(=O)CN(Cc2ccco2)C2CC2)s1 |
| InChI | InChI=1S/C15H17NO2S/c1-11-4-7-15(19-11)14(17)10-16(12-5-6-12)9-13-3-2-8-18-13/h2-4,7-8,12H,5-6,9-10H2,1H3 |
| InChIKey | CSBGHYNQIKECQF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |