C18H34O5Si — CID 10316378
ethyl (2E,4S,5S,6E)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)octa-2,6-dienoate (PubChem CID 10316378) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is ethyl (2E,4S,5S,6E)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)octa-2,6-dienoate.
| Compound Name | ethyl (2E,4S,5S,6E)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)octa-2,6-dienoate |
|---|---|
| PubChem CID | 10316378 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | ethyl (2E,4S,5S,6E)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)octa-2,6-dienoate |
| SMILES | C/C=C/[C@H](OCOC)[C@H](/C=C/C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O5Si/c1-9-11-15(22-14-20-6)16(12-13-17(19)21-10-2)23-24(7,8)18(3,4)5/h9,11-13,15-16H,10,14H2,1-8H3/b11-9+,13-12+/t15-,16-/m0/s1 |
| InChIKey | JGYXYYNANFKFML-QOMQLUSASA-N |
| XLogP | 4.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|