C22H43IO3Si2 — CID 10875196
2-trimethylsilylethyl (2E,4S,5R,6E)-7-iodo-4-methyl-5-tri(propan-2-yl)silyloxyhepta-2,6-dienoate (PubChem CID 10875196) has the molecular formula C22H43IO3Si2 and a molecular weight of 538.66 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2E,4S,5R,6E)-7-iodo-4-methyl-5-tri(propan-2-yl)silyloxyhepta-2,6-dienoate.
| Compound Name | 2-trimethylsilylethyl (2E,4S,5R,6E)-7-iodo-4-methyl-5-tri(propan-2-yl)silyloxyhepta-2,6-dienoate |
|---|---|
| PubChem CID | 10875196 |
| Molecular Formula | C22H43IO3Si2 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 2-trimethylsilylethyl (2E,4S,5R,6E)-7-iodo-4-methyl-5-tri(propan-2-yl)silyloxyhepta-2,6-dienoate |
| SMILES | CC(C)[Si](O[C@@H](/C=C/I)[C@@H](C)/C=C/C(=O)OCC[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H43IO3Si2/c1-17(2)28(18(3)4,19(5)6)26-21(13-14-23)20(7)11-12-22(24)25-15-16-27(8,9)10/h11-14,17-21H,15-16H2,1-10H3/b12-11+,14-13+/t20-,21-/m0/s1 |
| InChIKey | JSQBOMXMLBKXNC-MJZMEJJMSA-N |
| XLogP | 7.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|